C18H14ClNO2S3 — CID 46257305
(5Z)-5-[[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 46257305) has the molecular formula C18H14ClNO2S3 and a molecular weight of 407.97 g/mol. Its IUPAC name is (5Z)-5-[[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46257305 |
| Molecular Formula | C18H14ClNO2S3 |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | (5Z)-5-[[5-[(4-chlorophenyl)methylsulfanyl]furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(SCc3ccc(Cl)cc3)o2)SC1=S |
| InChI | InChI=1S/C18H14ClNO2S3/c1-2-9-20-17(21)15(25-18(20)23)10-14-7-8-16(22-14)24-11-12-3-5-13(19)6-4-12/h2-8,10H,1,9,11H2/b15-10- |
| InChIKey | VKDGYROJUIOZEW-GDNBJRDFSA-N |
| XLogP | 5.61 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|