About 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile
4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile (PubChem CID 4625744) has the molecular formula C6H4N6
and a molecular weight of 160.14 g/mol. Its IUPAC name is 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
| PubChem CID | 4625744 |
| Molecular Formula | C6H4N6 |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
| SMILES | N#Cc1nnc2ccnn2c1N |
| InChI | InChI=1S/C6H4N6/c7-3-4-6(8)12-5(11-10-4)1-2-9-12/h1-2H,8H2 |
| InChIKey | IBDFEAAYRWQLBK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile?
The IUPAC name of 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile (CID 4625744) is 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile.
What is the SMILES notation for 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile?
The canonical SMILES for 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile is N#Cc1nnc2ccnn2c1N.
What is the InChIKey of 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile?
The InChIKey is IBDFEAAYRWQLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N6/c7-3-4-6(8)12-5(11-10-4)1-2-9-12/h1-2H,8H2.
What are the key properties of 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile?
4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile has a molecular weight of 160.14 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile is sourced from PubChem (CID 4625744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).