C13H9F2N3O2 — CID 46259712
2-(2,4-difluorophenyl)-1-hydroxy-4H-1,2,4-benzotriazin-3-one (PubChem CID 46259712) has the molecular formula C13H9F2N3O2 and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-hydroxy-4H-1,2,4-benzotriazin-3-one.
| Compound Name | 2-(2,4-difluorophenyl)-1-hydroxy-4H-1,2,4-benzotriazin-3-one |
|---|---|
| PubChem CID | 46259712 |
| Molecular Formula | C13H9F2N3O2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-hydroxy-4H-1,2,4-benzotriazin-3-one |
| SMILES | O=C1Nc2ccccc2N(O)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C13H9F2N3O2/c14-8-5-6-11(9(15)7-8)17-13(19)16-10-3-1-2-4-12(10)18(17)20/h1-7,20H,(H,16,19) |
| InChIKey | GIZGDZUUOPPVAH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |