C19H15F5N2O4S — CID 46260574
2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 46260574) has the molecular formula C19H15F5N2O4S and a molecular weight of 462.40 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 46260574 |
| Molecular Formula | C19H15F5N2O4S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-(2,2-dimethyl-1,1,4-trioxo-3H-1λ6,5-benzothiazepin-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | CC1(C)CC(=O)N(CC(=O)Nc2c(F)c(F)c(F)c(F)c2F)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H15F5N2O4S/c1-19(2)7-12(28)26(9-5-3-4-6-10(9)31(19,29)30)8-11(27)25-18-16(23)14(21)13(20)15(22)17(18)24/h3-6H,7-8H2,1-2H3,(H,25,27) |
| InChIKey | NSKVVNTZAMUCKL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|