C22H24N6O5 — CID 46261394
2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-methylamino]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 46261394) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-methylamino]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-methylamino]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46261394 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-methylamino]-1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(-c2noc(N(C)CC(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C22H24N6O5/c1-25(22-23-21(24-33-22)16-3-9-19(32-2)10-4-16)15-20(29)27-13-11-26(12-14-27)17-5-7-18(8-6-17)28(30)31/h3-10H,11-15H2,1-2H3 |
| InChIKey | BQBVDMLSBJNIOT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|