C20H21N4O2P — CID 4626169
1-ethoxy-2,7-dimethyl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide (PubChem CID 4626169) has the molecular formula C20H21N4O2P and a molecular weight of 380.39 g/mol. Its IUPAC name is 1-ethoxy-2,7-dimethyl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-2,7-dimethyl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide |
|---|---|
| PubChem CID | 4626169 |
| Molecular Formula | C20H21N4O2P |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-ethoxy-2,7-dimethyl-3,5-diphenylpyrazolo[4,5-c][1,5,2]diazaphosphinine 1-oxide |
| SMILES | CCOP1(=O)c2c(C)nn(-c3ccccc3)c2N=C(c2ccccc2)N1C |
| InChI | InChI=1S/C20H21N4O2P/c1-4-26-27(25)18-15(2)22-24(17-13-9-6-10-14-17)20(18)21-19(23(27)3)16-11-7-5-8-12-16/h5-14H,4H2,1-3H3 |
| InChIKey | SZOIYXMDQNPDON-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|