C21H22N4O4 — CID 46261801
N'-(furan-2-ylmethyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide (PubChem CID 46261801) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide.
| Compound Name | N'-(furan-2-ylmethyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide |
|---|---|
| PubChem CID | 46261801 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N'-methyl-N-(12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-2-yl)oxamide |
| SMILES | CN(Cc1ccco1)C(=O)C(=O)Nc1ccc2nc3n(c(=O)c2c1)CCCCC3 |
| InChI | InChI=1S/C21H22N4O4/c1-24(13-15-6-5-11-29-15)21(28)19(26)22-14-8-9-17-16(12-14)20(27)25-10-4-2-3-7-18(25)23-17/h5-6,8-9,11-12H,2-4,7,10,13H2,1H3,(H,22,26) |
| InChIKey | ZPKMSHNNNJHHLN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|