About N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide
N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide (PubChem CID 4626251) has the molecular formula C16H24N2O3S2
and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide |
| PubChem CID | 4626251 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(=S)NC1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H24N2O3S2/c19-14(18-15(22)17-13-1-2-23(20,21)9-13)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-13H,1-9H2,(H2,17,18,19,22) |
| InChIKey | VXGRSEZVRLMBEG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide?
The IUPAC name of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide (CID 4626251) is N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide?
The canonical SMILES for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide is O=C(NC(=S)NC1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide?
The InChIKey is VXGRSEZVRLMBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3S2/c19-14(18-15(22)17-13-1-2-23(20,21)9-13)16-6-10-3-11(7-16)5-12(4-10)8-16/h10-13H,1-9H2,(H2,17,18,19,22).
What are the key properties of N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide?
N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide has a molecular weight of 356.51 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothiolan-3-yl)carbamothioyl]adamantane-1-carboxamide is sourced from PubChem (CID 4626251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).