C24H24N2O4 — CID 46262594
(1R,3R,6R,7R,9S)-N-[3-[methyl-(3-methylphenyl)carbamoyl]phenyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide (PubChem CID 46262594) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1R,3R,6R,7R,9S)-N-[3-[methyl-(3-methylphenyl)carbamoyl]phenyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide.
| Compound Name | (1R,3R,6R,7R,9S)-N-[3-[methyl-(3-methylphenyl)carbamoyl]phenyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
|---|---|
| PubChem CID | 46262594 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (1R,3R,6R,7R,9S)-N-[3-[methyl-(3-methylphenyl)carbamoyl]phenyl]-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| SMILES | Cc1cccc(N(C)C(=O)c2cccc(NC(=O)[C@H]3[C@@H]4C[C@@H]5[C@H]3C(=O)O[C@@H]5C4)c2)c1 |
| InChI | InChI=1S/C24H24N2O4/c1-13-5-3-8-17(9-13)26(2)23(28)14-6-4-7-16(10-14)25-22(27)20-15-11-18-19(12-15)30-24(29)21(18)20/h3-10,15,18-21H,11-12H2,1-2H3,(H,25,27)/t15-,18+,19-,20+,21-/m1/s1 |
| InChIKey | QMESIXMSZZVOJT-VHQPJYBDSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |