About N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide
N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 46265315) has the molecular formula C18H28N4OS
and a molecular weight of 348.52 g/mol. Its IUPAC name is N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide.
Molecular Properties
| Compound Name | N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide |
| PubChem CID | 46265315 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1csc(-n2nc(C)c(CCCC)c2C)n1 |
| InChI | InChI=1S/C18H28N4OS/c1-5-7-9-16-13(3)21-22(14(16)4)18-20-15(12-24-18)11-17(23)19-10-8-6-2/h12H,5-11H2,1-4H3,(H,19,23) |
| InChIKey | VXRCFTVXYYYXOY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide?
The IUPAC name of N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide (CID 46265315) is N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide.
What is the SMILES notation for N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide?
The canonical SMILES for N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide is CCCCNC(=O)Cc1csc(-n2nc(C)c(CCCC)c2C)n1.
What is the InChIKey of N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide?
The InChIKey is VXRCFTVXYYYXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4OS/c1-5-7-9-16-13(3)21-22(14(16)4)18-20-15(12-24-18)11-17(23)19-10-8-6-2/h12H,5-11H2,1-4H3,(H,19,23).
What are the key properties of N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide?
N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide has a molecular weight of 348.52 g/mol, XLogP of 3.75, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-[2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-thiazol-4-yl]acetamide is sourced from PubChem (CID 46265315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).