C18H21N5O4S2 — CID 46265500
2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 46265500) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46265500 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)Nc3nnc(CC(C)C)s3)o2)cc1OC |
| InChI | InChI=1S/C18H21N5O4S2/c1-10(2)7-15-20-22-17(29-15)19-14(24)9-28-18-23-21-16(27-18)11-5-6-12(25-3)13(8-11)26-4/h5-6,8,10H,7,9H2,1-4H3,(H,19,22,24) |
| InChIKey | VVKOJXFAWYERJH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |