C19H21N5OS — CID 4626703
1-(2,3-dihydro-1H-inden-2-yl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 4626703) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 4626703 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1noc(C)c1Cn1cc(NC(=S)NC2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C19H21N5OS/c1-12-18(13(2)25-23-12)11-24-10-17(9-20-24)22-19(26)21-16-7-14-5-3-4-6-15(14)8-16/h3-6,9-10,16H,7-8,11H2,1-2H3,(H2,21,22,26) |
| InChIKey | KWGSBDPIBLZJHA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|