C21H28N6O4S — CID 46268042
N-[4-[4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 46268042) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[4-[4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 46268042 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[4-[4-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3cc(N4CCOCC4)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C21H28N6O4S/c1-16-22-20(15-21(23-16)26-11-13-31-14-12-26)25-7-9-27(10-8-25)32(29,30)19-5-3-18(4-6-19)24-17(2)28/h3-6,15H,7-14H2,1-2H3,(H,24,28) |
| InChIKey | NKYBGQQFFZYZPP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |