C20H17N5O4 — CID 46270747
2-[2-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 46270747) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-[2-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46270747 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[2-[4-([1,3]oxazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CCN(c2nc3cccnc3o2)CC1 |
| InChI | InChI=1S/C20H17N5O4/c26-16(12-25-18(27)13-4-1-2-5-14(13)19(25)28)23-8-10-24(11-9-23)20-22-15-6-3-7-21-17(15)29-20/h1-7H,8-12H2 |
| InChIKey | UZUOBCWBYCJUSV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|