C15H9F5N4O2 — CID 46271459
2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 46271459) has the molecular formula C15H9F5N4O2 and a molecular weight of 372.25 g/mol. Its IUPAC name is 2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | 2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 46271459 |
| Molecular Formula | C15H9F5N4O2 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2c(F)c(F)c(F)c(F)c2F)c(=O)c2cccn12 |
| InChI | InChI=1S/C15H9F5N4O2/c1-6-22-24(15(26)7-3-2-4-23(6)7)5-8(25)21-14-12(19)10(17)9(16)11(18)13(14)20/h2-4H,5H2,1H3,(H,21,25) |
| InChIKey | UGTMDZUXADELRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|