About 2,4-diamino-1,5-diphenylpentan-3-ol
2,4-diamino-1,5-diphenylpentan-3-ol (PubChem CID 4627394) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 2,4-diamino-1,5-diphenylpentan-3-ol.
Molecular Properties
| Compound Name | 2,4-diamino-1,5-diphenylpentan-3-ol |
| PubChem CID | 4627394 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2,4-diamino-1,5-diphenylpentan-3-ol |
| SMILES | NC(Cc1ccccc1)C(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O/c18-15(11-13-7-3-1-4-8-13)17(20)16(19)12-14-9-5-2-6-10-14/h1-10,15-17,20H,11-12,18-19H2 |
| InChIKey | GZBLEJZADHZBBZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-diamino-1,5-diphenylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-1,5-diphenylpentan-3-ol?
The IUPAC name of 2,4-diamino-1,5-diphenylpentan-3-ol (CID 4627394) is 2,4-diamino-1,5-diphenylpentan-3-ol.
What is the SMILES notation for 2,4-diamino-1,5-diphenylpentan-3-ol?
The canonical SMILES for 2,4-diamino-1,5-diphenylpentan-3-ol is NC(Cc1ccccc1)C(O)C(N)Cc1ccccc1.
What is the InChIKey of 2,4-diamino-1,5-diphenylpentan-3-ol?
The InChIKey is GZBLEJZADHZBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c18-15(11-13-7-3-1-4-8-13)17(20)16(19)12-14-9-5-2-6-10-14/h1-10,15-17,20H,11-12,18-19H2.
What are the key properties of 2,4-diamino-1,5-diphenylpentan-3-ol?
2,4-diamino-1,5-diphenylpentan-3-ol has a molecular weight of 270.38 g/mol, XLogP of 1.49, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-1,5-diphenylpentan-3-ol is sourced from PubChem (CID 4627394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).