C25H35N3O4 — CID 46274227
N-cyclohexyl-6-(furan-2-yl)-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 46274227) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is N-cyclohexyl-6-(furan-2-yl)-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | N-cyclohexyl-6-(furan-2-yl)-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 46274227 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | N-cyclohexyl-6-(furan-2-yl)-3-methyl-1-oxo-2-(3-propan-2-yloxypropyl)-4H-pyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CC(C)OCCCN1C(=O)c2ccc(-c3ccco3)n2CC1(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H35N3O4/c1-18(2)31-16-8-14-28-23(29)21-13-12-20(22-11-7-15-32-22)27(21)17-25(28,3)24(30)26-19-9-5-4-6-10-19/h7,11-13,15,18-19H,4-6,8-10,14,16-17H2,1-3H3,(H,26,30) |
| InChIKey | CDIBFNKJVUFUDK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|