C27H36N4O4 — CID 46275109
N-[2-(1-adamantyloxy)ethyl]-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-3-carboxamide (PubChem CID 46275109) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[2-(1-adamantyloxy)ethyl]-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(1-adamantyloxy)ethyl]-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46275109 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[2-(1-adamantyloxy)ethyl]-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-3-carboxamide |
| SMILES | COc1ccc(-c2noc(N3CCCC(C(=O)NCCOC45CC6CC(CC(C6)C4)C5)C3)n2)cc1 |
| InChI | InChI=1S/C27H36N4O4/c1-33-23-6-4-21(5-7-23)24-29-26(35-30-24)31-9-2-3-22(17-31)25(32)28-8-10-34-27-14-18-11-19(15-27)13-20(12-18)16-27/h4-7,18-20,22H,2-3,8-17H2,1H3,(H,28,32) |
| InChIKey | XDKZBEUJOZCBPM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|