C25H25FN4O2S — CID 46275474
4-[[2-[(3-fluorophenyl)methylsulfanyl]imidazo[4,5-b]pyridin-3-yl]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 46275474) has the molecular formula C25H25FN4O2S and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[[2-[(3-fluorophenyl)methylsulfanyl]imidazo[4,5-b]pyridin-3-yl]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[2-[(3-fluorophenyl)methylsulfanyl]imidazo[4,5-b]pyridin-3-yl]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 46275474 |
| Molecular Formula | C25H25FN4O2S |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-[[2-[(3-fluorophenyl)methylsulfanyl]imidazo[4,5-b]pyridin-3-yl]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(Cn2c(SCc3cccc(F)c3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C25H25FN4O2S/c1-32-14-4-13-28-24(31)20-10-8-18(9-11-20)16-30-23-22(7-3-12-27-23)29-25(30)33-17-19-5-2-6-21(26)15-19/h2-3,5-12,15H,4,13-14,16-17H2,1H3,(H,28,31) |
| InChIKey | MDMFMFNRDYKWRA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|