About N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide
N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 46276118) has the molecular formula C19H20N4O4S
and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 46276118 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccno2)c1)c1cc(S(=O)(=O)N2CCCCC2)c[nH]1 |
| InChI | InChI=1S/C19H20N4O4S/c24-19(22-15-6-4-5-14(11-15)18-7-8-21-27-18)17-12-16(13-20-17)28(25,26)23-9-2-1-3-10-23/h4-8,11-13,20H,1-3,9-10H2,(H,22,24) |
| InChIKey | OXOTYUSHGGTMOT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide?
The IUPAC name of N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide (CID 46276118) is N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide is O=C(Nc1cccc(-c2ccno2)c1)c1cc(S(=O)(=O)N2CCCCC2)c[nH]1.
What is the InChIKey of N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide?
The InChIKey is OXOTYUSHGGTMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O4S/c24-19(22-15-6-4-5-14(11-15)18-7-8-21-27-18)17-12-16(13-20-17)28(25,26)23-9-2-1-3-10-23/h4-8,11-13,20H,1-3,9-10H2,(H,22,24).
What are the key properties of N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide?
N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide has a molecular weight of 400.46 g/mol, XLogP of 3.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,2-oxazol-5-yl)phenyl]-4-piperidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 46276118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).