C25H18FN3O5S — CID 46276625
2-amino-4-(3,4-dihydroxyphenyl)-6-[(4-fluorophenyl)methyl]-5,5-dioxo-4H-pyrano[3,2-c][2,1]benzothiazine-3-carbonitrile (PubChem CID 46276625) has the molecular formula C25H18FN3O5S and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-amino-4-(3,4-dihydroxyphenyl)-6-[(4-fluorophenyl)methyl]-5,5-dioxo-4H-pyrano[3,2-c][2,1]benzothiazine-3-carbonitrile.
| Compound Name | 2-amino-4-(3,4-dihydroxyphenyl)-6-[(4-fluorophenyl)methyl]-5,5-dioxo-4H-pyrano[3,2-c][2,1]benzothiazine-3-carbonitrile |
|---|---|
| PubChem CID | 46276625 |
| Molecular Formula | C25H18FN3O5S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-amino-4-(3,4-dihydroxyphenyl)-6-[(4-fluorophenyl)methyl]-5,5-dioxo-4H-pyrano[3,2-c][2,1]benzothiazine-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C1c1ccc(O)c(O)c1)S(=O)(=O)N(Cc1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C25H18FN3O5S/c26-16-8-5-14(6-9-16)13-29-19-4-2-1-3-17(19)23-24(35(29,32)33)22(18(12-27)25(28)34-23)15-7-10-20(30)21(31)11-15/h1-11,22,30-31H,13,28H2 |
| InChIKey | IXABWKGQABKHRI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|