C20H15FN4O4S — CID 46277864
2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5-methyl-2-pyridinyl)benzenesulfonamide (PubChem CID 46277864) has the molecular formula C20H15FN4O4S and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5-methyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5-methyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46277864 |
| Molecular Formula | C20H15FN4O4S |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5-methyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(F)ccc2CN2C(=O)c3cccnc3C2=O)nc1 |
| InChI | InChI=1S/C20H15FN4O4S/c1-12-4-7-17(23-10-12)24-30(28,29)16-9-14(21)6-5-13(16)11-25-19(26)15-3-2-8-22-18(15)20(25)27/h2-10H,11H2,1H3,(H,23,24) |
| InChIKey | OJIKWRUBJKHLKU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|