C28H28FN3O2 — CID 46278362
2-[3-[4-(2-fluorophenyl)piperazin-1-yl]-1-(4-methylphenyl)-3-oxopropyl]-3H-isoindol-1-one (PubChem CID 46278362) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-[3-[4-(2-fluorophenyl)piperazin-1-yl]-1-(4-methylphenyl)-3-oxopropyl]-3H-isoindol-1-one.
| Compound Name | 2-[3-[4-(2-fluorophenyl)piperazin-1-yl]-1-(4-methylphenyl)-3-oxopropyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 46278362 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-[3-[4-(2-fluorophenyl)piperazin-1-yl]-1-(4-methylphenyl)-3-oxopropyl]-3H-isoindol-1-one |
| SMILES | Cc1ccc(C(CC(=O)N2CCN(c3ccccc3F)CC2)N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H28FN3O2/c1-20-10-12-21(13-11-20)26(32-19-22-6-2-3-7-23(22)28(32)34)18-27(33)31-16-14-30(15-17-31)25-9-5-4-8-24(25)29/h2-13,26H,14-19H2,1H3 |
| InChIKey | OZECWWCWOCQRDS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |