C24H32N6O5 — CID 46278464
1-(4-methylpiperidin-1-yl)-3-[3-[[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]methyl]-1,2,4-oxadiazol-5-yl]propan-1-one (PubChem CID 46278464) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-3-[3-[[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]methyl]-1,2,4-oxadiazol-5-yl]propan-1-one.
| Compound Name | 1-(4-methylpiperidin-1-yl)-3-[3-[[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]methyl]-1,2,4-oxadiazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 46278464 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-3-[3-[[4-[2-(3-nitrophenyl)acetyl]piperazin-1-yl]methyl]-1,2,4-oxadiazol-5-yl]propan-1-one |
| SMILES | CC1CCN(C(=O)CCc2nc(CN3CCN(C(=O)Cc4cccc([N+](=O)[O-])c4)CC3)no2)CC1 |
| InChI | InChI=1S/C24H32N6O5/c1-18-7-9-28(10-8-18)23(31)6-5-22-25-21(26-35-22)17-27-11-13-29(14-12-27)24(32)16-19-3-2-4-20(15-19)30(33)34/h2-4,15,18H,5-14,16-17H2,1H3 |
| InChIKey | MEMWOMGTZWYMGO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|