C22H19ClF4N4O — CID 46280305
1-(3-chloro-2-methylphenyl)-5-piperidin-4-yl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide (PubChem CID 46280305) has the molecular formula C22H19ClF4N4O and a molecular weight of 466.87 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-5-piperidin-4-yl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chloro-2-methylphenyl)-5-piperidin-4-yl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46280305 |
| Molecular Formula | C22H19ClF4N4O |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-5-piperidin-4-yl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1-n1ncc(C(=O)Nc2c(F)c(F)cc(F)c2F)c1C1CCNCC1 |
| InChI | InChI=1S/C22H19ClF4N4O/c1-11-14(23)3-2-4-17(11)31-21(12-5-7-28-8-6-12)13(10-29-31)22(32)30-20-18(26)15(24)9-16(25)19(20)27/h2-4,9-10,12,28H,5-8H2,1H3,(H,30,32) |
| InChIKey | SPUPIGIKGFWJEA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|