C20H21N5O4 — CID 46280377
6-methyl-N-(2-methyl-3-nitrophenyl)-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide (PubChem CID 46280377) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6-methyl-N-(2-methyl-3-nitrophenyl)-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 6-methyl-N-(2-methyl-3-nitrophenyl)-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 46280377 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 6-methyl-N-(2-methyl-3-nitrophenyl)-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncnc(N3CCCCC3)c2c1C(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H21N5O4/c1-12-14(7-6-8-15(12)25(27)28)23-19(26)16-13(2)29-20-17(16)18(21-11-22-20)24-9-4-3-5-10-24/h6-8,11H,3-5,9-10H2,1-2H3,(H,23,26) |
| InChIKey | ASXHDHDFUJRSIU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|