C23H31ClN4O4 — CID 46281345
tert-butyl 4-[1-(2-chlorophenyl)-4-(2-methoxyethylcarbamoyl)pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 46281345) has the molecular formula C23H31ClN4O4 and a molecular weight of 462.98 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-chlorophenyl)-4-(2-methoxyethylcarbamoyl)pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-chlorophenyl)-4-(2-methoxyethylcarbamoyl)pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46281345 |
| Molecular Formula | C23H31ClN4O4 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | tert-butyl 4-[1-(2-chlorophenyl)-4-(2-methoxyethylcarbamoyl)pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | COCCNC(=O)c1cnn(-c2ccccc2Cl)c1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H31ClN4O4/c1-23(2,3)32-22(30)27-12-9-16(10-13-27)20-17(21(29)25-11-14-31-4)15-26-28(20)19-8-6-5-7-18(19)24/h5-8,15-16H,9-14H2,1-4H3,(H,25,29) |
| InChIKey | UOTNGJJREAMPIX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|