C23H29N5O2 — CID 46282527
N-butyl-4-[2-(1-methylindol-3-yl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-4-oxobutanamide (PubChem CID 46282527) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-butyl-4-[2-(1-methylindol-3-yl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-4-oxobutanamide.
| Compound Name | N-butyl-4-[2-(1-methylindol-3-yl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 46282527 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-butyl-4-[2-(1-methylindol-3-yl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-4-oxobutanamide |
| SMILES | CCCCNC(=O)CCC(=O)N1CCCn2nc(-c3cn(C)c4ccccc34)cc21 |
| InChI | InChI=1S/C23H29N5O2/c1-3-4-12-24-21(29)10-11-23(30)27-13-7-14-28-22(27)15-19(25-28)18-16-26(2)20-9-6-5-8-17(18)20/h5-6,8-9,15-16H,3-4,7,10-14H2,1-2H3,(H,24,29) |
| InChIKey | YTYWPVWRFOMCOX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|