C26H25ClN4O — CID 46283061
4-chloro-N-[N-(2-ethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide (PubChem CID 46283061) has the molecular formula C26H25ClN4O and a molecular weight of 444.97 g/mol. Its IUPAC name is 4-chloro-N-[N-(2-ethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(2-ethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46283061 |
| Molecular Formula | C26H25ClN4O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-chloro-N-[N-(2-ethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
| SMILES | CCc1ccccc1N/C(=N/CCc1c[nH]c2ccccc12)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN4O/c1-2-18-7-3-5-9-23(18)30-26(31-25(32)19-11-13-21(27)14-12-19)28-16-15-20-17-29-24-10-6-4-8-22(20)24/h3-14,17,29H,2,15-16H2,1H3,(H2,28,30,31,32) |
| InChIKey | CMFKBUFUXWRHAY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|