C11H19NO — CID 4628434
2-methyl-N,N-bis(prop-2-enyl)butanamide (PubChem CID 4628434) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-methyl-N,N-bis(prop-2-enyl)butanamide.
| Compound Name | 2-methyl-N,N-bis(prop-2-enyl)butanamide |
|---|---|
| PubChem CID | 4628434 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-methyl-N,N-bis(prop-2-enyl)butanamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)CC |
| InChI | InChI=1S/C11H19NO/c1-5-8-12(9-6-2)11(13)10(4)7-3/h5-6,10H,1-2,7-9H2,3-4H3 |
| InChIKey | IINXCOPHHHNLRY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|