C24H24F2N2O3 — CID 46286169
1-[1,3-bis(4-fluorophenyl)propan-2-yl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 46286169) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is 1-[1,3-bis(4-fluorophenyl)propan-2-yl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[1,3-bis(4-fluorophenyl)propan-2-yl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46286169 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[1,3-bis(4-fluorophenyl)propan-2-yl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC(Cc2ccc(F)cc2)Cc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H24F2N2O3/c1-30-21-11-12-22(23(15-21)31-2)28-24(29)27-20(13-16-3-7-18(25)8-4-16)14-17-5-9-19(26)10-6-17/h3-12,15,20H,13-14H2,1-2H3,(H2,27,28,29) |
| InChIKey | IPZNDJUYCVXCQP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |