About ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate
ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate (PubChem CID 46286527) has the molecular formula C21H23N5O3
and a molecular weight of 393.45 g/mol. Its IUPAC name is ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate.
Molecular Properties
| Compound Name | ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate |
| PubChem CID | 46286527 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1CCC(n2cnc3cccnc32)CC1 |
| InChI | InChI=1S/C21H23N5O3/c1-2-29-20(27)16-6-3-4-7-17(16)24-21(28)25-12-9-15(10-13-25)26-14-23-18-8-5-11-22-19(18)26/h3-8,11,14-15H,2,9-10,12-13H2,1H3,(H,24,28) |
| InChIKey | FXJHPCPRJIBEBQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate?
The IUPAC name of ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate (CID 46286527) is ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate.
What is the SMILES notation for ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate?
The canonical SMILES for ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate is CCOC(=O)c1ccccc1NC(=O)N1CCC(n2cnc3cccnc32)CC1.
What is the InChIKey of ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate?
The InChIKey is FXJHPCPRJIBEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O3/c1-2-29-20(27)16-6-3-4-7-17(16)24-21(28)25-12-9-15(10-13-25)26-14-23-18-8-5-11-22-19(18)26/h3-8,11,14-15H,2,9-10,12-13H2,1H3,(H,24,28).
What are the key properties of ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate?
ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate has a molecular weight of 393.45 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carbonyl)amino]benzoate is sourced from PubChem (CID 46286527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).