C19H19F3N4O2 — CID 46287097
1-(4-ethoxyphenyl)-3-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]urea (PubChem CID 46287097) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 46287097 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCn2c(C(F)(F)F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H19F3N4O2/c1-2-28-14-9-7-13(8-10-14)24-18(27)23-11-12-26-16-6-4-3-5-15(16)25-17(26)19(20,21)22/h3-10H,2,11-12H2,1H3,(H2,23,24,27) |
| InChIKey | LFYYHDWMKOPDRW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |