C23H18N4O2 — CID 4628846
8-ethyl-6-imino-1,3-diphenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4628846) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 8-ethyl-6-imino-1,3-diphenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 8-ethyl-6-imino-1,3-diphenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4628846 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 8-ethyl-6-imino-1,3-diphenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccccc3)OC(c3ccccc3)C(C#N)(C#N)C1(C#N)C2CC |
| InChI | InChI=1S/C23H18N4O2/c1-2-18-22(15-26)20(27)29-23(18,17-11-7-4-8-12-17)28-19(21(22,13-24)14-25)16-9-5-3-6-10-16/h3-12,18-19,27H,2H2,1H3/b27-20- |
| InChIKey | LFOORWBKNYIEPH-OOAXWGSJSA-N |
| XLogP | 4.19 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|