About 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one
5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (PubChem CID 46289248) has the molecular formula C21H32N4O
and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| PubChem CID | 46289248 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| SMILES | CN1CCN(C2/C(=N/C(C)(C)C)N(c3ccccc3)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C21H32N4O/c1-20(2,3)22-18-17(24-14-12-23(6)13-15-24)21(4,5)19(26)25(18)16-10-8-7-9-11-16/h7-11,17H,12-15H2,1-6H3/b22-18- |
| InChIKey | AGSBXSFEHFHVJV-PYCFMQQDSA-N |
| XLogP | 2.87 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The IUPAC name of 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (CID 46289248) is 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
What is the SMILES notation for 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The canonical SMILES for 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is CN1CCN(C2/C(=N/C(C)(C)C)N(c3ccccc3)C(=O)C2(C)C)CC1.
What is the InChIKey of 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The InChIKey is AGSBXSFEHFHVJV-PYCFMQQDSA-N. The full InChI is InChI=1S/C21H32N4O/c1-20(2,3)22-18-17(24-14-12-23(6)13-15-24)21(4,5)19(26)25(18)16-10-8-7-9-11-16/h7-11,17H,12-15H2,1-6H3/b22-18-.
What are the key properties of 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one has a molecular weight of 356.51 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 46289248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).