About 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one
5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (PubChem CID 46289249) has the molecular formula C23H34N4O
and a molecular weight of 382.55 g/mol. Its IUPAC name is 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| PubChem CID | 46289249 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| SMILES | CN1CCN(C2/C(=N/C3CCCCC3)N(c3ccccc3)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C23H34N4O/c1-23(2)20(26-16-14-25(3)15-17-26)21(24-18-10-6-4-7-11-18)27(22(23)28)19-12-8-5-9-13-19/h5,8-9,12-13,18,20H,4,6-7,10-11,14-17H2,1-3H3/b24-21- |
| InChIKey | FYPATJLEQWWTFU-FLFQWRMESA-N |
| XLogP | 3.41 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The IUPAC name of 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (CID 46289249) is 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
What is the SMILES notation for 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The canonical SMILES for 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is CN1CCN(C2/C(=N/C3CCCCC3)N(c3ccccc3)C(=O)C2(C)C)CC1.
What is the InChIKey of 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The InChIKey is FYPATJLEQWWTFU-FLFQWRMESA-N. The full InChI is InChI=1S/C23H34N4O/c1-23(2)20(26-16-14-25(3)15-17-26)21(24-18-10-6-4-7-11-18)27(22(23)28)19-12-8-5-9-13-19/h5,8-9,12-13,18,20H,4,6-7,10-11,14-17H2,1-3H3/b24-21-.
What are the key properties of 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one has a molecular weight of 382.55 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylimino-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 46289249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).