About 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one
5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (PubChem CID 46289250) has the molecular formula C27H38N4O
and a molecular weight of 434.63 g/mol. Its IUPAC name is 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| PubChem CID | 46289250 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one |
| SMILES | CN1CCN(C2/C(=N/C34CC5CC(CC(C5)C3)C4)N(c3ccccc3)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C27H38N4O/c1-26(2)23(30-11-9-29(3)10-12-30)24(31(25(26)32)22-7-5-4-6-8-22)28-27-16-19-13-20(17-27)15-21(14-19)18-27/h4-8,19-21,23H,9-18H2,1-3H3/b28-24- |
| InChIKey | OEZKJDVBZYXMIP-COOPMVRXSA-N |
| XLogP | 4.04 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The IUPAC name of 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one (CID 46289250) is 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one.
What is the SMILES notation for 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The canonical SMILES for 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is CN1CCN(C2/C(=N/C34CC5CC(CC(C5)C3)C4)N(c3ccccc3)C(=O)C2(C)C)CC1.
What is the InChIKey of 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
The InChIKey is OEZKJDVBZYXMIP-COOPMVRXSA-N. The full InChI is InChI=1S/C27H38N4O/c1-26(2)23(30-11-9-29(3)10-12-30)24(31(25(26)32)22-7-5-4-6-8-22)28-27-16-19-13-20(17-27)15-21(14-19)18-27/h4-8,19-21,23H,9-18H2,1-3H3/b28-24-.
What are the key properties of 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one?
5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one has a molecular weight of 434.63 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-adamantylimino)-3,3-dimethyl-4-(4-methylpiperazin-1-yl)-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 46289250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).