C30H40N4O — CID 46289312
2-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-1-one (PubChem CID 46289312) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-1-one.
| Compound Name | 2-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 46289312 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 2-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)-3-(2,4,6-trimethylphenyl)imino-2-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2C(=O)C3(CCCCC3)C(N3CCN(C)CC3)/C2=N/c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C30H40N4O/c1-21-9-11-25(12-10-21)34-28(31-26-23(3)19-22(2)20-24(26)4)27(33-17-15-32(5)16-18-33)30(29(34)35)13-7-6-8-14-30/h9-12,19-20,27H,6-8,13-18H2,1-5H3/b31-28- |
| InChIKey | KVYSPCBCBJHIHJ-PNOGMODKSA-N |
| XLogP | 5.56 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|