C24H30N4O2S — CID 46289608
N-[4-(diethylamino)-2-methylphenyl]-3-[2-(propanoylamino)-1,3-benzothiazol-6-yl]propanamide (PubChem CID 46289608) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3-[2-(propanoylamino)-1,3-benzothiazol-6-yl]propanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3-[2-(propanoylamino)-1,3-benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 46289608 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3-[2-(propanoylamino)-1,3-benzothiazol-6-yl]propanamide |
| SMILES | CCC(=O)Nc1nc2ccc(CCC(=O)Nc3ccc(N(CC)CC)cc3C)cc2s1 |
| InChI | InChI=1S/C24H30N4O2S/c1-5-22(29)27-24-26-20-11-8-17(15-21(20)31-24)9-13-23(30)25-19-12-10-18(14-16(19)4)28(6-2)7-3/h8,10-12,14-15H,5-7,9,13H2,1-4H3,(H,25,30)(H,26,27,29) |
| InChIKey | OMZXDNWEAQPOKY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|