C22H24N4O3S — CID 46289696
N-[6-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 46289696) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[6-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46289696 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[6-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3ccc4nc(NC(C)=O)sc4c3)CC2)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c1-15(27)23-22-24-19-8-3-16(13-20(19)30-22)14-21(28)26-11-9-25(10-12-26)17-4-6-18(29-2)7-5-17/h3-8,13H,9-12,14H2,1-2H3,(H,23,24,27) |
| InChIKey | JHFNMBLEGAOVIV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|