C18H16N4O3S — CID 46291416
N-(2,1,3-benzothiadiazol-4-yl)-2-(3-oxo-1,4-benzoxazin-4-yl)butanamide (PubChem CID 46291416) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-(3-oxo-1,4-benzoxazin-4-yl)butanamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(3-oxo-1,4-benzoxazin-4-yl)butanamide |
|---|---|
| PubChem CID | 46291416 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(3-oxo-1,4-benzoxazin-4-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cccc2nsnc12)N1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C18H16N4O3S/c1-2-13(22-14-8-3-4-9-15(14)25-10-16(22)23)18(24)19-11-6-5-7-12-17(11)21-26-20-12/h3-9,13H,2,10H2,1H3,(H,19,24) |
| InChIKey | FAJIBFJMDQFRQY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |