C20H25N3O5S — CID 46291791
4-(4-ethylpiperazin-1-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 46291791) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46291791 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-3-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | CCN1CCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O5S/c1-3-22-10-12-23(13-11-22)19-9-4-15(20(24)25)14-18(19)21-29(26,27)17-7-5-16(28-2)6-8-17/h4-9,14,21H,3,10-13H2,1-2H3,(H,24,25) |
| InChIKey | KDBOGGOJPXWLRW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |