C17H19BrN2O4S2 — CID 46292370
3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(3-methylpiperidin-1-yl)benzoic acid (PubChem CID 46292370) has the molecular formula C17H19BrN2O4S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(3-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(3-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46292370 |
| Molecular Formula | C17H19BrN2O4S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-4-(3-methylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CCCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C17H19BrN2O4S2/c1-11-3-2-8-20(10-11)14-5-4-12(17(21)22)9-13(14)19-26(23,24)16-7-6-15(18)25-16/h4-7,9,11,19H,2-3,8,10H2,1H3,(H,21,22) |
| InChIKey | QFAMGRSIPBAABH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |