C17H17ClO7 — CID 4629460
6-(4-chlorophenoxy)-2-(furan-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 4629460) has the molecular formula C17H17ClO7 and a molecular weight of 368.77 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-(furan-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | 6-(4-chlorophenoxy)-2-(furan-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 4629460 |
| Molecular Formula | C17H17ClO7 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-(furan-2-yl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | OC1C(Oc2ccc(Cl)cc2)OC2COC(c3ccco3)OC2C1O |
| InChI | InChI=1S/C17H17ClO7/c18-9-3-5-10(6-4-9)23-17-14(20)13(19)15-12(24-17)8-22-16(25-15)11-2-1-7-21-11/h1-7,12-17,19-20H,8H2 |
| InChIKey | SPJMEJOZODHPJS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |