C20H29N3O4S — CID 46294824
2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 46294824) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 46294824 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | O=C(CC1CCN(S(=O)(=O)c2ccccc2)CC1)NCCCN1CCCC1=O |
| InChI | InChI=1S/C20H29N3O4S/c24-19(21-11-5-13-22-12-4-8-20(22)25)16-17-9-14-23(15-10-17)28(26,27)18-6-2-1-3-7-18/h1-3,6-7,17H,4-5,8-16H2,(H,21,24) |
| InChIKey | LCDJUFYNQCDPDL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|