C21H25FN2O3S — CID 46294908
N-[(3-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetamide (PubChem CID 46294908) has the molecular formula C21H25FN2O3S and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 46294908 |
| Molecular Formula | C21H25FN2O3S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CC(=O)NCc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25FN2O3S/c1-16-5-7-20(8-6-16)28(26,27)24-11-9-17(10-12-24)14-21(25)23-15-18-3-2-4-19(22)13-18/h2-8,13,17H,9-12,14-15H2,1H3,(H,23,25) |
| InChIKey | ABOKCSTWXXVFDR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |