C28H23ClO6 — CID 4629565
[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-ethyl-2-methyl-4-oxochromen-7-yl] 4-chlorobenzoate (PubChem CID 4629565) has the molecular formula C28H23ClO6 and a molecular weight of 490.94 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-ethyl-2-methyl-4-oxochromen-7-yl] 4-chlorobenzoate.
| Compound Name | [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-ethyl-2-methyl-4-oxochromen-7-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4629565 |
| Molecular Formula | C28H23ClO6 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-ethyl-2-methyl-4-oxochromen-7-yl] 4-chlorobenzoate |
| SMILES | CCc1cc2c(=O)c(-c3ccc4c(c3)OCCCO4)c(C)oc2cc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H23ClO6/c1-3-17-13-21-24(15-23(17)35-28(31)18-5-8-20(29)9-6-18)34-16(2)26(27(21)30)19-7-10-22-25(14-19)33-12-4-11-32-22/h5-10,13-15H,3-4,11-12H2,1-2H3 |
| InChIKey | NAUQVFONWLKQGX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|