C27H26ClN3O3 — CID 46296832
(2E)-N-[3-[benzyl(methyl)amino]propyl]-2-[(3-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 46296832) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is (2E)-N-[3-[benzyl(methyl)amino]propyl]-2-[(3-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2E)-N-[3-[benzyl(methyl)amino]propyl]-2-[(3-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 46296832 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2E)-N-[3-[benzyl(methyl)amino]propyl]-2-[(3-chlorophenyl)methylidene]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1cccc(Cl)c1)O2)Cc1ccccc1 |
| InChI | InChI=1S/C27H26ClN3O3/c1-31(18-19-7-3-2-4-8-19)14-6-13-29-26(32)21-11-12-24-23(17-21)30-27(33)25(34-24)16-20-9-5-10-22(28)15-20/h2-5,7-12,15-17H,6,13-14,18H2,1H3,(H,29,32)(H,30,33)/b25-16+ |
| InChIKey | QFZBFQUEHNLKAS-PCLIKHOPSA-N |
| XLogP | 4.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|