C25H28ClN3O3 — CID 46296847
(2Z)-2-[(3-chlorophenyl)methylidene]-N-[2-[cyclohexyl(methyl)amino]ethyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 46296847) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is (2Z)-2-[(3-chlorophenyl)methylidene]-N-[2-[cyclohexyl(methyl)amino]ethyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2Z)-2-[(3-chlorophenyl)methylidene]-N-[2-[cyclohexyl(methyl)amino]ethyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 46296847 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (2Z)-2-[(3-chlorophenyl)methylidene]-N-[2-[cyclohexyl(methyl)amino]ethyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CN(CCNC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1cccc(Cl)c1)O2)C1CCCCC1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-29(20-8-3-2-4-9-20)13-12-27-24(30)18-10-11-22-21(16-18)28-25(31)23(32-22)15-17-6-5-7-19(26)14-17/h5-7,10-11,14-16,20H,2-4,8-9,12-13H2,1H3,(H,27,30)(H,28,31)/b23-15- |
| InChIKey | KCPLDUFWNNVCPD-HAHDFKILSA-N |
| XLogP | 4.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|