C24H20FNO5S2 — CID 46297335
(3,4-dimethoxyphenyl)-[6-fluoro-4-(3-methylsulfanylphenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]methanone (PubChem CID 46297335) has the molecular formula C24H20FNO5S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[6-fluoro-4-(3-methylsulfanylphenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[6-fluoro-4-(3-methylsulfanylphenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]methanone |
|---|---|
| PubChem CID | 46297335 |
| Molecular Formula | C24H20FNO5S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[6-fluoro-4-(3-methylsulfanylphenyl)-1,1-dioxo-1λ6,4-benzothiazin-2-yl]methanone |
| SMILES | COc1ccc(C(=O)C2=CN(c3cccc(SC)c3)c3cc(F)ccc3S2(=O)=O)cc1OC |
| InChI | InChI=1S/C24H20FNO5S2/c1-30-20-9-7-15(11-21(20)31-2)24(27)23-14-26(17-5-4-6-18(13-17)32-3)19-12-16(25)8-10-22(19)33(23,28)29/h4-14H,1-3H3 |
| InChIKey | ZQCUCIIWMSNYLV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|